Products 2155851-98-0

CAS 2155851-98-0 is the registry number for Methyl 2-amino-3-(3-phenoxyphenyl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-(3-phenoxyphenyl)propanoate;hydrochloride (CAS 2155851-98-0) is a chemical compound with the molecular formula C16H18ClNO3 and a molecular weight of 307.77 g/mol. IUPAC name: methyl 2-amino-3-(3-phenoxyphenyl)propanoate;hydrochloride. InChIKey: SONDOLRJTYXGSX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18ClNO3
Molecular weight307.77 g/mol
IUPAC namemethyl 2-amino-3-(3-phenoxyphenyl)propanoate;hydrochloride
InChIKeySONDOLRJTYXGSX-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CC(=CC=C1)OC2=CC=CC=C2)N.Cl

Computed by PubChem (NCBI)