CAS 2155855-77-7 is the registry number for 3-OH-Kynurenamine (dihydroiodide), 99.56%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.
3-amino-1-(2-amino-3-hydroxyphenyl)propan-1-one;dihydroiodide (CAS 2155855-77-7) is a chemical compound with the molecular formula C9H14I2N2O2 and a molecular weight of 436.03 g/mol. IUPAC name: 3-amino-1-(2-amino-3-hydroxyphenyl)propan-1-one;dihydroiodide. InChIKey: QQALFAATVHWQHY-UHFFFAOYSA-N.
| Molecular formula | C9H14I2N2O2 |
|---|---|
| Molecular weight | 436.03 g/mol |
| IUPAC name | 3-amino-1-(2-amino-3-hydroxyphenyl)propan-1-one;dihydroiodide |
| InChIKey | QQALFAATVHWQHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)N)C(=O)CCN.I.I |
Computed by PubChem (NCBI)