CAS 2155855-78-8 is the registry number for 1-(1H-1,2,3,4-Tetrazol-5-yl)piperazine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2H-tetrazol-5-yl)piperazine;dihydrochloride (CAS 2155855-78-8) is a chemical compound with the molecular formula C5H12Cl2N6 and a molecular weight of 227.09 g/mol. IUPAC name: 1-(2H-tetrazol-5-yl)piperazine;dihydrochloride. InChIKey: NQAXMYJWMIBFLE-UHFFFAOYSA-N.
| Molecular formula | C5H12Cl2N6 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 1-(2H-tetrazol-5-yl)piperazine;dihydrochloride |
| InChIKey | NQAXMYJWMIBFLE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NNN=N2.Cl.Cl |
Computed by PubChem (NCBI)