Products 2155856-02-1

CAS 2155856-02-1 is the registry number for Methyl 5-oxa-9-azaspiro(3.5)nonane-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 5-oxa-9-azaspiro[3.5]nonane-2-carboxylate (CAS 2155856-02-1) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: methyl 5-oxa-9-azaspiro[3.5]nonane-2-carboxylate. InChIKey: VGLANDDYIYGQFW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15NO3
Molecular weight185.22 g/mol
IUPAC namemethyl 5-oxa-9-azaspiro[3.5]nonane-2-carboxylate
InChIKeyVGLANDDYIYGQFW-UHFFFAOYSA-N
SMILESCOC(=O)C1CC2(C1)NCCCO2

Computed by PubChem (NCBI)