Products 2155871-19-3

CAS 2155871-19-3 is the registry number for 4-Methanesulfonyloxymethyl-bicyclo[2.2.2]octane-1-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(methylsulfonyloxymethyl)bicyclo[2.2.2]octane-1-carboxylate (CAS 2155871-19-3) is a chemical compound with the molecular formula C12H20O5S and a molecular weight of 276.35 g/mol. IUPAC name: methyl 4-(methylsulfonyloxymethyl)bicyclo[2.2.2]octane-1-carboxylate. InChIKey: BWZHDTLLOVXLAL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20O5S
Molecular weight276.35 g/mol
IUPAC namemethyl 4-(methylsulfonyloxymethyl)bicyclo[2.2.2]octane-1-carboxylate
InChIKeyBWZHDTLLOVXLAL-UHFFFAOYSA-N
SMILESCOC(=O)C12CCC(CC1)(CC2)COS(=O)(=O)C

Computed by PubChem (NCBI)