CAS 2156-14-1 is the registry number for 2-([1,1'-Biphenyl]-4-yl)-1H-indene-1,3(2H)-dione, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-phenylphenyl)indene-1,3-dione (CAS 2156-14-1) is a chemical compound with the molecular formula C21H14O2 and a molecular weight of 298.3 g/mol. IUPAC name: 2-(4-phenylphenyl)indene-1,3-dione. InChIKey: FKIGKEFBTLDBNH-UHFFFAOYSA-N.
| Molecular formula | C21H14O2 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | 2-(4-phenylphenyl)indene-1,3-dione |
| InChIKey | FKIGKEFBTLDBNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)