CAS 215611-93-1 appears in our catalog under these names: Poly({9,9-dioctylfluorenyl-2,7-diyl}-co-{1,4-(2,5-dimethoxy)benzene}) end capped with dimethylphenyl, PPDN, PPDN 95% Sublimed, Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile, 95% Sublimed, 95% Sublimed. Offered by: Lumtec, GLPBio, Ambeed, Chemat. Available pack sizes: On request, 1g, 50mg, 100mg, 250mg.
Pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile (CAS 215611-93-1) is a chemical compound with the molecular formula C16H6N6 and a molecular weight of 282.26 g/mol. IUPAC name: pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile. InChIKey: LYKXFSYCKWNWEZ-UHFFFAOYSA-N.
| Molecular formula | C16H6N6 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | pyrazino[2,3-f][1,10]phenanthroline-2,3-dicarbonitrile |
| InChIKey | LYKXFSYCKWNWEZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C4=NC(=C(N=C24)C#N)C#N)N=C1 |
Computed by PubChem (NCBI)