Products 21562-54-9
CAS 21562-54-9 appears in our catalog under these names: 15(R)–Prostaglandin F1α, 15(R)-Prostaglandin f1α, 15(R)-Prostaglandin F1α, 15beta-PGF1ALPHA. Offered by: GLPBio, Biosynth, MedChemExpress, Sigma-Aldrich. Available pack sizes: 1mg, 100μg, 500μg, 10mg, 5mg, 25mg, 50mg, Get quote.
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoic acid (CAS 21562-54-9) is a chemical compound with the molecular formula C20H36O5 and a molecular weight of 356.5 g/mol. IUPAC name: 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoic acid. InChIKey: DZUXGQBLFALXCR-HBYHEDERSA-N.
| Molecular formula | C20H36O5 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxyoct-1-enyl]cyclopentyl]heptanoic acid |
| InChIKey | DZUXGQBLFALXCR-HBYHEDERSA-N |
| SMILES | CCCCC[C@H](/C=C/[C@H]1[C@@H](C[C@@H]([C@@H]1CCCCCCC(=O)O)O)O)O |
Computed by PubChem (NCBI)