CAS 215649-79-9 is the registry number for 1-(3-(Trifluoromethoxy)phenyl) piperazin-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[3-(trifluoromethoxy)phenyl]piperazin-2-one (CAS 215649-79-9) is a chemical compound with the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. IUPAC name: 1-[3-(trifluoromethoxy)phenyl]piperazin-2-one. InChIKey: XJFWLJGWEYXTDT-UHFFFAOYSA-N.
| Molecular formula | C11H11F3N2O2 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | 1-[3-(trifluoromethoxy)phenyl]piperazin-2-one |
| InChIKey | XJFWLJGWEYXTDT-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)C2=CC(=CC=C2)OC(F)(F)F |
Computed by PubChem (NCBI)