Products 2156649-32-8
CAS 2156649-32-8 is the registry number for Elunetirom, 99.24%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10mM/1mL, 10 mg, 25 mg, 5 mg.
2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-N-methylacetamide (CAS 2156649-32-8) is a chemical compound with the molecular formula C19H21Cl2NO3 and a molecular weight of 382.3 g/mol. IUPAC name: 2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-N-methylacetamide. InChIKey: CQELSEDWYWTMDG-UHFFFAOYSA-N.
| Molecular formula | C19H21Cl2NO3 |
|---|---|
| Molecular weight | 382.3 g/mol |
| IUPAC name | 2-[3,5-dichloro-4-[(4-hydroxy-3-propan-2-ylphenyl)methyl]phenoxy]-N-methylacetamide |
| InChIKey | CQELSEDWYWTMDG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC(=C1)CC2=C(C=C(C=C2Cl)OCC(=O)NC)Cl)O |
Computed by PubChem (NCBI)