CAS 2157-19-9 appears in our catalog under these names: Endosulfan Impurity 2, Endosulfandiol, Endosulfan-alcohol, Endosulfan alcohol. Offered by: Hubei YoungXin, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
[1,4,5,6,7,7-hexachloro-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol (CAS 2157-19-9) is a chemical compound with the molecular formula C9H8Cl6O2 and a molecular weight of 360.9 g/mol. IUPAC name: [1,4,5,6,7,7-hexachloro-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol. InChIKey: GTSJHTSVFKEASK-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl6O2 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | [1,4,5,6,7,7-hexachloro-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| InChIKey | GTSJHTSVFKEASK-UHFFFAOYSA-N |
| SMILES | C(C1C(C2(C(=C(C1(C2(Cl)Cl)Cl)Cl)Cl)Cl)CO)O |
Computed by PubChem (NCBI)