Products 215789-29-0
CAS 215789-29-0 appears in our catalog under these names: Indole-C2-amide-C2-NH2, Indole–C2–amide–C2–NH2, Indole-C2-amide-C2-NH2, 99.42%, Indole-C2-amide-C2-NH2, 97%, N-(2-(1H-Indol-3-yl)ethyl)-3-aminopropanamide, 97%. Offered by: TargetMol, GLPBio, MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 2mg, 100mg, 50mg, 10mM/1mL, 100 mg, 50 mg, 25 mg, 250mg.
3-amino-N-[2-(1H-indol-3-yl)ethyl]propanamide (CAS 215789-29-0) is a chemical compound with the molecular formula C13H17N3O and a molecular weight of 231.29 g/mol. IUPAC name: 3-amino-N-[2-(1H-indol-3-yl)ethyl]propanamide. InChIKey: ANPPXRSQOVOACQ-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 3-amino-N-[2-(1H-indol-3-yl)ethyl]propanamide |
| InChIKey | ANPPXRSQOVOACQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)CCN |
Computed by PubChem (NCBI)