Products 2158298-68-9
CAS 2158298-68-9 is the registry number for 1-Bromo-3-chloro-2-fluoro-5-(methoxymethoxy)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3-chloro-2-fluoro-5-(methoxymethoxy)benzene (CAS 2158298-68-9) is a chemical compound with the molecular formula C8H7BrClFO2 and a molecular weight of 269.49 g/mol. IUPAC name: 1-bromo-3-chloro-2-fluoro-5-(methoxymethoxy)benzene. InChIKey: LGJMZAILODFIIA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClFO2 |
|---|---|
| Molecular weight | 269.49 g/mol |
| IUPAC name | 1-bromo-3-chloro-2-fluoro-5-(methoxymethoxy)benzene |
| InChIKey | LGJMZAILODFIIA-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=C(C(=C1)Br)F)Cl |
Computed by PubChem (NCBI)