CAS 215855-85-9 is the registry number for Allopregnandiol 3-(Hydrogen Sulfate) Sodium Salt. Offered by: TRC. Available pack sizes: 100mg.
CAS 215855-85-9 identifies a chemical compound with the molecular formula C21H35NaO5S- and a molecular weight of 422.6 g/mol. InChIKey: GZXKKTNZJDCFRW-GHUMFHMSSA-M.
| Molecular formula | C21H35NaO5S- |
|---|---|
| Molecular weight | 422.6 g/mol |
| InChIKey | GZXKKTNZJDCFRW-GHUMFHMSSA-M |
| SMILES | C[C@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@@H](C4)OS(=O)(=O)[O-])C)C)O.[Na] |
Computed by PubChem (NCBI)