Products 215868-29-4
CAS 215868-29-4 is the registry number for 6, 8-Difluoro-7-hydroxy-4-methylcoumarin NHS ester. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,5-dioxopyrrolidin-1-yl) 2-(6,8-difluoro-7-hydroxy-4-methyl-2-oxochromen-3-yl)acetate (CAS 215868-29-4) is a chemical compound with the molecular formula C16H11F2NO7 and a molecular weight of 367.26 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-(6,8-difluoro-7-hydroxy-4-methyl-2-oxochromen-3-yl)acetate. InChIKey: VTOZCHLUHBJLNI-UHFFFAOYSA-N.
| Molecular formula | C16H11F2NO7 |
|---|---|
| Molecular weight | 367.26 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-(6,8-difluoro-7-hydroxy-4-methyl-2-oxochromen-3-yl)acetate |
| InChIKey | VTOZCHLUHBJLNI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C(C(=C(C=C12)F)O)F)CC(=O)ON3C(=O)CCC3=O |
Computed by PubChem (NCBI)