CAS 2159074-44-7 is the registry number for Potassium trifluoro(isobutyramidomethyl)borate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium trifluoro-[(2-methylpropanoylamino)methyl]boranuide (CAS 2159074-44-7) is a chemical compound with the molecular formula C5H10BF3KNO and a molecular weight of 207.05 g/mol. IUPAC name: potassium trifluoro-[(2-methylpropanoylamino)methyl]boranuide. InChIKey: LHOBLFGSFKKTFX-UHFFFAOYSA-N.
| Molecular formula | C5H10BF3KNO |
|---|---|
| Molecular weight | 207.05 g/mol |
| IUPAC name | potassium trifluoro-[(2-methylpropanoylamino)methyl]boranuide |
| InChIKey | LHOBLFGSFKKTFX-UHFFFAOYSA-N |
| SMILES | [B-](CNC(=O)C(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)