CAS 2160555-55-3 appears in our catalog under these names: Cumyl PeGACLONE, 2,5-dihydro-2-(1-methyl-1-phenylethyl)-5-pentyl-1H-pyrido(4,3-b)indol-1-one. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 10mg, 5mg, 25mg, 50mg.
5-pentyl-2-(2-phenylpropan-2-yl)pyrido[4,3-b]indol-1-one (CAS 2160555-55-3) is a chemical compound with the molecular formula C25H28N2O and a molecular weight of 372.5 g/mol. IUPAC name: 5-pentyl-2-(2-phenylpropan-2-yl)pyrido[4,3-b]indol-1-one. InChIKey: AWHWTKXMUJLSRM-UHFFFAOYSA-N.
| Molecular formula | C25H28N2O |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | 5-pentyl-2-(2-phenylpropan-2-yl)pyrido[4,3-b]indol-1-one |
| InChIKey | AWHWTKXMUJLSRM-UHFFFAOYSA-N |
| SMILES | CCCCCN1C2=C(C3=CC=CC=C31)C(=O)N(C=C2)C(C)(C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)