CAS 2161096-01-9 is the registry number for rac-(3aR,4R,6aS)-2-Methyl-octahydrocyclopenta(C)pyrrol-4-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3aS,4S,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol (CAS 2161096-01-9) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. IUPAC name: (3aS,4S,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol. InChIKey: WRMUFPIDTHIMLB-RNJXMRFFSA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | (3aS,4S,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-ol |
| InChIKey | WRMUFPIDTHIMLB-RNJXMRFFSA-N |
| SMILES | CN1C[C@@H]2CC[C@@H]([C@@H]2C1)O |
Computed by PubChem (NCBI)