CAS 2161394-94-9 appears in our catalog under these names: Canagliflozin Furanose Impurity, Canagliflozin Furanose Form (Mixture of Anomers), >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg.
2-(1,2-dihydroxyethyl)-5-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]oxolane-3,4-diol (CAS 2161394-94-9) is a chemical compound with the molecular formula C24H25FO5S and a molecular weight of 444.5 g/mol. IUPAC name: 2-(1,2-dihydroxyethyl)-5-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]oxolane-3,4-diol. InChIKey: ZLPSHXQANWMHSC-UHFFFAOYSA-N.
| Molecular formula | C24H25FO5S |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | 2-(1,2-dihydroxyethyl)-5-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]oxolane-3,4-diol |
| InChIKey | ZLPSHXQANWMHSC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2C(C(C(O2)C(CO)O)O)O)CC3=CC=C(S3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)