CAS 21625-70-7 is the registry number for N-Desethyl-E-Clomiphene Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 0,5mg, 1mg, 2,5mg, 10mg, 5mg, 25mg, 50mg.
2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]-N-ethylethanamine;hydrochloride (CAS 21625-70-7) is a chemical compound with the molecular formula C24H25Cl2NO and a molecular weight of 414.4 g/mol. IUPAC name: 2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]-N-ethylethanamine;hydrochloride. InChIKey: SYRIDNBWUGYGDO-XMXXDQCKSA-N.
| Molecular formula | C24H25Cl2NO |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | 2-[4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy]-N-ethylethanamine;hydrochloride |
| InChIKey | SYRIDNBWUGYGDO-XMXXDQCKSA-N |
| SMILES | CCNCCOC1=CC=C(C=C1)/C(=C(\C2=CC=CC=C2)/Cl)/C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)