CAS 216299-25-1 is the registry number for 1,1'-(Pyridine-2,6-diyl)bis(4,4,4-trifluorobutane-1,3-dione), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4,4,4-trifluoro-1-[6-(4,4,4-trifluoro-3-oxobutanoyl)-2-pyridinyl]butane-1,3-dione (CAS 216299-25-1) is a chemical compound with the molecular formula C13H7F6NO4 and a molecular weight of 355.19 g/mol. IUPAC name: 4,4,4-trifluoro-1-[6-(4,4,4-trifluoro-3-oxobutanoyl)-2-pyridinyl]butane-1,3-dione. InChIKey: IAVKBGWGYNVYCO-UHFFFAOYSA-N.
| Molecular formula | C13H7F6NO4 |
|---|---|
| Molecular weight | 355.19 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-[6-(4,4,4-trifluoro-3-oxobutanoyl)-2-pyridinyl]butane-1,3-dione |
| InChIKey | IAVKBGWGYNVYCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)CC(=O)C(F)(F)F)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)