CAS 21638-99-3 is the registry number for 6-amino-4-(trifluoromethyl)-1,3,5-triazin-2(1H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
4-amino-6-(trifluoromethyl)-1H-1,3,5-triazin-2-one (CAS 21638-99-3) is a chemical compound with the molecular formula C4H3F3N4O and a molecular weight of 180.09 g/mol. IUPAC name: 4-amino-6-(trifluoromethyl)-1H-1,3,5-triazin-2-one. InChIKey: FDFFUNMRNUMHCU-UHFFFAOYSA-N.
| Molecular formula | C4H3F3N4O |
|---|---|
| Molecular weight | 180.09 g/mol |
| IUPAC name | 4-amino-6-(trifluoromethyl)-1H-1,3,5-triazin-2-one |
| InChIKey | FDFFUNMRNUMHCU-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=O)N1)N)C(F)(F)F |
Computed by PubChem (NCBI)