CAS 21639-39-4 appears in our catalog under these names: 2H-Benzo(e)(1,2,3)thiadiazine 1,1-dioxide, 95%, 2H-1,2,3-Benzothiadiazine 1,1-dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 25mg, 1g, 100mg.
2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide (CAS 21639-39-4) is a chemical compound with the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. IUPAC name: 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide. InChIKey: UOCUSOBVEHOMMB-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O2S |
|---|---|
| Molecular weight | 182.20 g/mol |
| IUPAC name | 2H-1lambda6,2,3-benzothiadiazine 1,1-dioxide |
| InChIKey | UOCUSOBVEHOMMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NNS2(=O)=O |
Computed by PubChem (NCBI)