CAS 2165186-07-0 is the registry number for 1–(3–Chloro–1,2,4–thiadiazol–5–yl)–4–(4–fluorophenyl)–piperazine. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
3-chloro-5-[4-(4-fluorophenyl)piperazin-1-yl]-1,2,4-thiadiazole (CAS 2165186-07-0) is a chemical compound with the molecular formula C12H12ClFN4S and a molecular weight of 298.77 g/mol. IUPAC name: 3-chloro-5-[4-(4-fluorophenyl)piperazin-1-yl]-1,2,4-thiadiazole. InChIKey: SFNCUYWSEQBGAO-UHFFFAOYSA-N.
| Molecular formula | C12H12ClFN4S |
|---|---|
| Molecular weight | 298.77 g/mol |
| IUPAC name | 3-chloro-5-[4-(4-fluorophenyl)piperazin-1-yl]-1,2,4-thiadiazole |
| InChIKey | SFNCUYWSEQBGAO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)F)C3=NC(=NS3)Cl |
Computed by PubChem (NCBI)