CAS 21652-58-4 appears in our catalog under these names: 1H,1H,2H-Perfluoro-1-decene, 98%, 1H,1H,2H-Perfluoro-1-decene, >95% (GC), 1H,1H,2H–Perfluoro–1–decene, 1H,1H,2H-PERFLUORO-1-DECENE, 99%. Offered by: Combi-blocks, TRC, GLPBio, Sigma-Aldrich. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 10g.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene (CAS 21652-58-4) is a chemical compound with the molecular formula C10H3F17 and a molecular weight of 446.10 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene. InChIKey: NKAMGQZDVMQEJL-UHFFFAOYSA-N.
| Molecular formula | C10H3F17 |
|---|---|
| Molecular weight | 446.10 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene |
| InChIKey | NKAMGQZDVMQEJL-UHFFFAOYSA-N |
| SMILES | C=CC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)