CAS 2165322-94-9 appears in our catalog under these names: USP25/28 inhibitor AZ1/ 99.79% (existing batch purity), USP25/28 inhibitor AZ1, 2-((5-Bromo-2-((4-fluoro-3-(trifluoromethyl)benzyl)oxy)benzyl)amino)ethan-1-ol, ≥98%, ≥98%, USP25/28 inhibitor AZ1, 98.0%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
2-[[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol (CAS 2165322-94-9) is a chemical compound with the molecular formula C17H16BrF4NO2 and a molecular weight of 422.2 g/mol. IUPAC name: 2-[[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol. InChIKey: ITHSFXDGKQYOED-UHFFFAOYSA-N.
| Molecular formula | C17H16BrF4NO2 |
|---|---|
| Molecular weight | 422.2 g/mol |
| IUPAC name | 2-[[5-bromo-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]ethanol |
| InChIKey | ITHSFXDGKQYOED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1COC2=C(C=C(C=C2)Br)CNCCO)C(F)(F)F)F |
Computed by PubChem (NCBI)