CAS 2165408-99-9 is the registry number for Ethyl (1R,3R,5R)-2-azabicyclo[3.1.0]hexane-3-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1R,3R,5R)-2-azabicyclo[3.1.0]hexane-3-carboxylate (CAS 2165408-99-9) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: ethyl (1R,3R,5R)-2-azabicyclo[3.1.0]hexane-3-carboxylate. InChIKey: IYUHWHWDNFNLTR-FSDSQADBSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | ethyl (1R,3R,5R)-2-azabicyclo[3.1.0]hexane-3-carboxylate |
| InChIKey | IYUHWHWDNFNLTR-FSDSQADBSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@H]2C[C@H]2N1 |
Computed by PubChem (NCBI)