CAS 2165502-08-7 is the registry number for (4Ar,7as)-1-(methylsulfonyl)octahydrothieno[3,4-b]pyrazine 6,6-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4aS,7aR)-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide (CAS 2165502-08-7) is a chemical compound with the molecular formula C7H14N2O4S2 and a molecular weight of 254.3 g/mol. IUPAC name: (4aS,7aR)-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide. InChIKey: YZPLMYIDTMEFOR-NKWVEPMBSA-N.
| Molecular formula | C7H14N2O4S2 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | (4aS,7aR)-4-methylsulfonyl-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine 6,6-dioxide |
| InChIKey | YZPLMYIDTMEFOR-NKWVEPMBSA-N |
| SMILES | CS(=O)(=O)N1CCN[C@@H]2[C@H]1CS(=O)(=O)C2 |
Computed by PubChem (NCBI)