Products 2165540-24-7
CAS 2165540-24-7 is the registry number for N-Boc-N-methyl-D-Valaldehyde. Offered by: MedChemExpress. Available pack sizes: 250 mg, 100 mg, 1 g.
Tert-butyl N-methyl-N-[(2R)-3-methyl-1-oxobutan-2-yl]carbamate (CAS 2165540-24-7) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl N-methyl-N-[(2R)-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: WZZUQWBUVSVLRT-VIFPVBQESA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[(2R)-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | WZZUQWBUVSVLRT-VIFPVBQESA-N |
| SMILES | CC(C)[C@H](C=O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)