Products 2165713-04-0
CAS 2165713-04-0 is the registry number for (3S,6S)-4-((tert-Butoxy)carbonyl)-6-methylmorpholine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3S,6S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid (CAS 2165713-04-0) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (3S,6S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid. InChIKey: YETZLQBPPWVQQU-YUMQZZPRSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (3S,6S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid |
| InChIKey | YETZLQBPPWVQQU-YUMQZZPRSA-N |
| SMILES | C[C@H]1CN([C@@H](CO1)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)