CAS 216581-01-0 appears in our catalog under these names: Cinnarizine EP Impurity E, Cinnarizine Impurity 5(Cinnarizine EP Impurity E), 1,4-Bis(benzhydryl)piperazine, 1,4-Bis(diphenylmethyl)piperazine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 4x25mg.
1,4-dibenzhydrylpiperazine (CAS 216581-01-0) is a chemical compound with the molecular formula C30H30N2 and a molecular weight of 418.6 g/mol. IUPAC name: 1,4-dibenzhydrylpiperazine. InChIKey: FLOADUFBZDDTPV-UHFFFAOYSA-N.
| Molecular formula | C30H30N2 |
|---|---|
| Molecular weight | 418.6 g/mol |
| IUPAC name | 1,4-dibenzhydrylpiperazine |
| InChIKey | FLOADUFBZDDTPV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)