Products 2165838-75-3
CAS 2165838-75-3 is the registry number for (S)-5-(((tert-Butyldimethylsilyl)oxy)methyl)morpholin-3-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholin-3-one (CAS 2165838-75-3) is a chemical compound with the molecular formula C11H23NO3Si and a molecular weight of 245.39 g/mol. IUPAC name: (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholin-3-one. InChIKey: LHEXPJVHTNJFSZ-VIFPVBQESA-N.
| Molecular formula | C11H23NO3Si |
|---|---|
| Molecular weight | 245.39 g/mol |
| IUPAC name | (5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]morpholin-3-one |
| InChIKey | LHEXPJVHTNJFSZ-VIFPVBQESA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1COCC(=O)N1 |
Computed by PubChem (NCBI)