CAS 216584-22-4 appears in our catalog under these names: N,N',N''-Tri-boc-guanidine, 98%, 1,2,3-Tris(tert-butoxycarbonyl)guanidine, >98.0%(T), N,N',N''-Tri-boc-guanidine, 98%, 98%, N,N',N''-TRI-BOC-GUANIDINE, 97%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 1g, 250mg, 10g.
Tert-butyl N-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (CAS 216584-22-4) is a chemical compound with the molecular formula C16H29N3O6 and a molecular weight of 359.42 g/mol. IUPAC name: tert-butyl N-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate. InChIKey: XZGNHTJSFCBWHG-UHFFFAOYSA-N.
| Molecular formula | C16H29N3O6 |
|---|---|
| Molecular weight | 359.42 g/mol |
| IUPAC name | tert-butyl N-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| InChIKey | XZGNHTJSFCBWHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)