CAS 2165871-95-2 is the registry number for (R)-5-Methyl-1-(methylsulfonyl)-1,4-diazepane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-5-methyl-1-methylsulfonyl-1,4-diazepane (CAS 2165871-95-2) is a chemical compound with the molecular formula C7H16N2O2S and a molecular weight of 192.28 g/mol. IUPAC name: (5R)-5-methyl-1-methylsulfonyl-1,4-diazepane. InChIKey: WLUHYCDCUDYGSC-SSDOTTSWSA-N.
| Molecular formula | C7H16N2O2S |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | (5R)-5-methyl-1-methylsulfonyl-1,4-diazepane |
| InChIKey | WLUHYCDCUDYGSC-SSDOTTSWSA-N |
| SMILES | C[C@@H]1CCN(CCN1)S(=O)(=O)C |
Computed by PubChem (NCBI)