Products 2165899-08-9
CAS 2165899-08-9 is the registry number for (3R)-3-((4R)-2,2-Dimethyl-1,3-dioxolan-4-yl)morpholine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]morpholine (CAS 2165899-08-9) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]morpholine. InChIKey: UYXKFGZNSQDFFS-SFYZADRCSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]morpholine |
| InChIKey | UYXKFGZNSQDFFS-SFYZADRCSA-N |
| SMILES | CC1(OC[C@H](O1)[C@H]2COCCN2)C |
Computed by PubChem (NCBI)