Products 2166007-42-5
CAS 2166007-42-5 is the registry number for (2S,6S)-2-Cyclopropyl-6-methylpiperidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,6S)-2-cyclopropyl-6-methylpiperidin-4-one (CAS 2166007-42-5) is a chemical compound with the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. IUPAC name: (2S,6S)-2-cyclopropyl-6-methylpiperidin-4-one. InChIKey: URHLGVNKVAEGGV-RCOVLWMOSA-N.
| Molecular formula | C9H15NO |
|---|---|
| Molecular weight | 153.22 g/mol |
| IUPAC name | (2S,6S)-2-cyclopropyl-6-methylpiperidin-4-one |
| InChIKey | URHLGVNKVAEGGV-RCOVLWMOSA-N |
| SMILES | C[C@H]1CC(=O)C[C@H](N1)C2CC2 |
Computed by PubChem (NCBI)