CAS 2166009-21-6 appears in our catalog under these names: (2S,6R)-4-((tert-Butoxy)carbonyl)-6-methylmorpholine-2-carboxylic acid, (2S,6R)-4-(TERT-BUTOXYCARBONYL)-6-METHYLMORPHOLINE-2-CARBOXYLIC ACID, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
(2S,6R)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid (CAS 2166009-21-6) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S,6R)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid. InChIKey: IJMIYSXHHOKJEZ-SFYZADRCSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S,6R)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid |
| InChIKey | IJMIYSXHHOKJEZ-SFYZADRCSA-N |
| SMILES | C[C@@H]1CN(C[C@H](O1)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)