CAS 2166009-86-3 is the registry number for (2S,3R)-2-((tert-Butoxycarbonyl)amino)-3-fluorobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 2166009-86-3) is a chemical compound with the molecular formula C9H16FNO4 and a molecular weight of 221.23 g/mol. IUPAC name: (2S,3R)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: XFZNDDRTARIPOU-PHDIDXHHSA-N.
| Molecular formula | C9H16FNO4 |
|---|---|
| Molecular weight | 221.23 g/mol |
| IUPAC name | (2S,3R)-3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | XFZNDDRTARIPOU-PHDIDXHHSA-N |
| SMILES | C[C@H]([C@H](C(=O)O)NC(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)