Products 2166017-06-5
CAS 2166017-06-5 appears in our catalog under these names: (S)–2–(benzylamino)–4–fluoro–4–methylpentanoic acid, (S)-2-(benzylamino)-4-fluoro-4-methylpentanoic acid, 96%, 96%, (S)-2-(benzylamino)-4-fluoro-4-methylpentanoic acid, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
(2S)-2-(benzylamino)-4-fluoro-4-methylpentanoic acid (CAS 2166017-06-5) is a chemical compound with the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. IUPAC name: (2S)-2-(benzylamino)-4-fluoro-4-methylpentanoic acid. InChIKey: ICPHPLXSJSGZTP-NSHDSACASA-N.
| Molecular formula | C13H18FNO2 |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | (2S)-2-(benzylamino)-4-fluoro-4-methylpentanoic acid |
| InChIKey | ICPHPLXSJSGZTP-NSHDSACASA-N |
| SMILES | CC(C)(C[C@@H](C(=O)O)NCC1=CC=CC=C1)F |
Computed by PubChem (NCBI)