CAS 2166234-38-2 is the registry number for (3S,5S)-1-Methyl-5-phenylpiperidin-3-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,5S)-1-methyl-5-phenylpiperidin-3-amine (CAS 2166234-38-2) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: (3S,5S)-1-methyl-5-phenylpiperidin-3-amine. InChIKey: QLFBYBVHBWHMAN-NEPJUHHUSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | (3S,5S)-1-methyl-5-phenylpiperidin-3-amine |
| InChIKey | QLFBYBVHBWHMAN-NEPJUHHUSA-N |
| SMILES | CN1C[C@@H](C[C@@H](C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)