Products 2166275-11-0
CAS 2166275-11-0 is the registry number for (R)-(1-(Methylsulfonyl)piperazin-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-1-methylsulfonylpiperazin-2-yl]methanol (CAS 2166275-11-0) is a chemical compound with the molecular formula C6H14N2O3S and a molecular weight of 194.25 g/mol. IUPAC name: [(2R)-1-methylsulfonylpiperazin-2-yl]methanol. InChIKey: KPBAVSDVYXQDNT-ZCFIWIBFSA-N.
| Molecular formula | C6H14N2O3S |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | [(2R)-1-methylsulfonylpiperazin-2-yl]methanol |
| InChIKey | KPBAVSDVYXQDNT-ZCFIWIBFSA-N |
| SMILES | CS(=O)(=O)N1CCNC[C@@H]1CO |
Computed by PubChem (NCBI)