Products 216655-61-7
CAS 216655-61-7 is the registry number for (5R)-2-Methylene-5-(1-methylethenyl)cyclohexanol (Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 250mg, 25mg.
(5R)-2-methylidene-5-prop-1-en-2-ylcyclohexan-1-ol (CAS 216655-61-7) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (5R)-2-methylidene-5-prop-1-en-2-ylcyclohexan-1-ol. InChIKey: PNVTXOFNJFHXOK-YHMJZVADSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (5R)-2-methylidene-5-prop-1-en-2-ylcyclohexan-1-ol |
| InChIKey | PNVTXOFNJFHXOK-YHMJZVADSA-N |
| SMILES | CC(=C)[C@@H]1CCC(=C)C(C1)O |
Computed by PubChem (NCBI)