CAS 21666-38-6 appears in our catalog under these names: N-Hexane-d14, >95% (GC), n-Hexane-d14 (Reagent grade), 99 atom % D, min 99% Chemical Purity, Hexane–d??, n-Hexane-d{14}, 99%(Isotopic) , n-Hexane-D14 99 atom % D. Offered by: TRC, CDN, GLPBio, Thermo Scientific (Alfa Aesar), Deutero. Available pack sizes: 100mg, 10mg, 50mg, 5g, 1g, 0,7ml, 5ml.
1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane (CAS 21666-38-6) is a chemical compound with the molecular formula C6H14 and a molecular weight of 100.26 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane. InChIKey: VLKZOEOYAKHREP-ZLKPZJALSA-N.
| Molecular formula | C6H14 |
|---|---|
| Molecular weight | 100.26 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecadeuteriohexane |
| InChIKey | VLKZOEOYAKHREP-ZLKPZJALSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)