Products 2166643-10-1

CAS 2166643-10-1 is the registry number for 3,3-Difluorooxolane-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 100mg.

3,3-difluorooxolane-2-carboxylic acid (CAS 2166643-10-1) is a chemical compound with the molecular formula C5H6F2O3 and a molecular weight of 152.10 g/mol. IUPAC name: 3,3-difluorooxolane-2-carboxylic acid. InChIKey: PLILKVHHFMIWOP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6F2O3
Molecular weight152.10 g/mol
IUPAC name3,3-difluorooxolane-2-carboxylic acid
InChIKeyPLILKVHHFMIWOP-UHFFFAOYSA-N
SMILESC1COC(C1(F)F)C(=O)O

Computed by PubChem (NCBI)