CAS 2166823-89-6 appears in our catalog under these names: cis-1-((tert-Butoxycarbonyl)amino)-3-methoxycyclobutane-1-carboxylic acid, 97%, (1S,3S)-1-{((tert-Butoxy)carbonyl)amino}-3-methoxycyclobutane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
3-methoxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 2166823-89-6) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 3-methoxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: DUZSBLQOTMZVAN-UHFFFAOYSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 3-methoxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | DUZSBLQOTMZVAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC(C1)OC)C(=O)O |
Computed by PubChem (NCBI)