Products 2166956-89-2

CAS 2166956-89-2 is the registry number for 3-(2-Hydroxypropan-2-yl)cyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2-hydroxypropan-2-yl)cyclobutane-1-carboxylic acid (CAS 2166956-89-2) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: 3-(2-hydroxypropan-2-yl)cyclobutane-1-carboxylic acid. InChIKey: ICEGZBJHMBTOFV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14O3
Molecular weight158.19 g/mol
IUPAC name3-(2-hydroxypropan-2-yl)cyclobutane-1-carboxylic acid
InChIKeyICEGZBJHMBTOFV-UHFFFAOYSA-N
SMILESCC(C)(C1CC(C1)C(=O)O)O

Computed by PubChem (NCBI)