CAS 2167386-95-8 is the registry number for Sodium 2-(4-(difluoromethoxy)pyridin-2-yl)acetate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Sodium 2-[4-(difluoromethoxy)-2-pyridinyl]acetate (CAS 2167386-95-8) is a chemical compound with the molecular formula C8H6F2NNaO3 and a molecular weight of 225.12 g/mol. IUPAC name: sodium 2-[4-(difluoromethoxy)-2-pyridinyl]acetate. InChIKey: XRGDKYLJEIGUQN-UHFFFAOYSA-M.
| Molecular formula | C8H6F2NNaO3 |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | sodium 2-[4-(difluoromethoxy)-2-pyridinyl]acetate |
| InChIKey | XRGDKYLJEIGUQN-UHFFFAOYSA-M |
| SMILES | C1=CN=C(C=C1OC(F)F)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)