CAS 2167517-92-0 is the registry number for 1,1-Dioxido-3,6-dihydro-2H-thiopyran-4-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl) trifluoromethanesulfonate (CAS 2167517-92-0) is a chemical compound with the molecular formula C6H7F3O5S2 and a molecular weight of 280.2 g/mol. IUPAC name: (1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl) trifluoromethanesulfonate. InChIKey: DQPGNMXRFIVELB-UHFFFAOYSA-N.
| Molecular formula | C6H7F3O5S2 |
|---|---|
| Molecular weight | 280.2 g/mol |
| IUPAC name | (1,1-dioxo-3,6-dihydro-2H-thiopyran-4-yl) trifluoromethanesulfonate |
| InChIKey | DQPGNMXRFIVELB-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC=C1OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)