CAS 216752-96-4 is the registry number for (E)-1-(Thiophen-2-yl)ethanone O-acetyl oxime, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
[(E)-1-thiophen-2-ylethylideneamino] acetate (CAS 216752-96-4) is a chemical compound with the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. IUPAC name: [(E)-1-thiophen-2-ylethylideneamino] acetate. InChIKey: QEELCYBMZZKIIB-RMKNXTFCSA-N.
| Molecular formula | C8H9NO2S |
|---|---|
| Molecular weight | 183.23 g/mol |
| IUPAC name | [(E)-1-thiophen-2-ylethylideneamino] acetate |
| InChIKey | QEELCYBMZZKIIB-RMKNXTFCSA-N |
| SMILES | C/C(=N\OC(=O)C)/C1=CC=CS1 |
Computed by PubChem (NCBI)