CAS 2167521-49-3 is the registry number for tert-Butyl 6-bromo-2,3-dihydro-1H-imidazo[1,2-a]imidazole-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-bromo-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxylate (CAS 2167521-49-3) is a chemical compound with the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. IUPAC name: tert-butyl 6-bromo-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxylate. InChIKey: MLZCOMCAXAAJTR-UHFFFAOYSA-N.
| Molecular formula | C10H14BrN3O2 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | tert-butyl 6-bromo-2,3-dihydroimidazo[1,2-a]imidazole-1-carboxylate |
| InChIKey | MLZCOMCAXAAJTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C1=NC(=C2)Br |
Computed by PubChem (NCBI)